C27H32ClN7O3S — CID 118722233
2-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 118722233) has the molecular formula C27H32ClN7O3S and a molecular weight of 570.12 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 118722233 |
| Molecular Formula | C27H32ClN7O3S |
| Molecular Weight | 570.12 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-N-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2cccc(NC(=O)CN3CCC4CNCC43)c2)ncc1Cl |
| InChI | InChI=1S/C27H32ClN7O3S/c1-17(2)39(37,38)24-9-4-3-8-22(24)33-26-21(28)14-30-27(34-26)32-20-7-5-6-19(12-20)31-25(36)16-35-11-10-18-13-29-15-23(18)35/h3-9,12,14,17-18,23,29H,10-11,13,15-16H2,1-2H3,(H,31,36)(H2,30,32,33,34) |
| InChIKey | HVZHUYCJAOSSBB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |