C18H20O4 — CID 118722266
2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 118722266) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 118722266 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | CC1(C)C2CC=C(C3CC(=O)c4c(O)cc(O)cc4O3)C1C2 |
| InChI | InChI=1S/C18H20O4/c1-18(2)9-3-4-11(12(18)5-9)15-8-14(21)17-13(20)6-10(19)7-16(17)22-15/h4,6-7,9,12,15,19-20H,3,5,8H2,1-2H3 |
| InChIKey | URBOYDCZBNMTQZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|