C21H20ClFN2O2S — CID 118722350
(4aS,10S,10aR)-8-(3-chloro-5-fluorophenyl)-4a-methylspiro[2,3,4,10a-tetrahydropyrano[3,2-b]chromene-10,4'-5H-1,3-thiazole]-2'-amine (PubChem CID 118722350) has the molecular formula C21H20ClFN2O2S and a molecular weight of 418.92 g/mol. Its IUPAC name is (4aS,10S,10aR)-8-(3-chloro-5-fluorophenyl)-4a-methylspiro[2,3,4,10a-tetrahydropyrano[3,2-b]chromene-10,4'-5H-1,3-thiazole]-2'-amine.
| Compound Name | (4aS,10S,10aR)-8-(3-chloro-5-fluorophenyl)-4a-methylspiro[2,3,4,10a-tetrahydropyrano[3,2-b]chromene-10,4'-5H-1,3-thiazole]-2'-amine |
|---|---|
| PubChem CID | 118722350 |
| Molecular Formula | C21H20ClFN2O2S |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (4aS,10S,10aR)-8-(3-chloro-5-fluorophenyl)-4a-methylspiro[2,3,4,10a-tetrahydropyrano[3,2-b]chromene-10,4'-5H-1,3-thiazole]-2'-amine |
| SMILES | C[C@]12CCCO[C@@H]1[C@]1(CSC(N)=N1)c1cc(-c3cc(F)cc(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C21H20ClFN2O2S/c1-20-5-2-6-26-18(20)21(11-28-19(24)25-21)16-9-12(3-4-17(16)27-20)13-7-14(22)10-15(23)8-13/h3-4,7-10,18H,2,5-6,11H2,1H3,(H2,24,25)/t18-,20-,21-/m0/s1 |
| InChIKey | YYSIZDVURBDWGB-JBACZVJFSA-N |
| XLogP | 4.73 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |