C26H30F3N3O2 — CID 118722405
(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 118722405) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 118722405 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-benzyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | N[C@@H](CC(=O)N1[C@H](C(=O)NCc2ccccc2)C[C@@H]2CCCC[C@@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H30F3N3O2/c27-20-14-22(29)21(28)11-18(20)10-19(30)13-25(33)32-23-9-5-4-8-17(23)12-24(32)26(34)31-15-16-6-2-1-3-7-16/h1-3,6-7,11,14,17,19,23-24H,4-5,8-10,12-13,15,30H2,(H,31,34)/t17-,19+,23-,24-/m0/s1 |
| InChIKey | HSGQEZWDMYGSPC-GOMRNUEMSA-N |
| XLogP | 3.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|