C21H27F3N2O3 — CID 118722410
[(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl acetate (PubChem CID 118722410) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl acetate.
| Compound Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118722410 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H27F3N2O3/c1-12(27)29-11-16-7-13-4-2-3-5-20(13)26(16)21(28)9-15(25)6-14-8-18(23)19(24)10-17(14)22/h8,10,13,15-16,20H,2-7,9,11,25H2,1H3/t13-,15+,16-,20-/m0/s1 |
| InChIKey | DJJDMDCQSLKDBW-YEOLMYPVSA-N |
| XLogP | 3.09 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|