C24H31F3N2O3 — CID 118722412
[(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclobutanecarboxylate (PubChem CID 118722412) has the molecular formula C24H31F3N2O3 and a molecular weight of 452.52 g/mol. Its IUPAC name is [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclobutanecarboxylate.
| Compound Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclobutanecarboxylate |
|---|---|
| PubChem CID | 118722412 |
| Molecular Formula | C24H31F3N2O3 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(2S,3aS,7aS)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]methyl cyclobutanecarboxylate |
| SMILES | N[C@@H](CC(=O)N1[C@H](COC(=O)C2CCC2)C[C@@H]2CCCC[C@@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C24H31F3N2O3/c25-19-12-21(27)20(26)10-16(19)8-17(28)11-23(30)29-18(9-15-4-1-2-7-22(15)29)13-32-24(31)14-5-3-6-14/h10,12,14-15,17-18,22H,1-9,11,13,28H2/t15-,17+,18-,22-/m0/s1 |
| InChIKey | CUPQJPMQXXJSAK-PBWVOLNLSA-N |
| XLogP | 3.87 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|