C19H25F3N2O2 — CID 118722415
(3R)-1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 118722415) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is (3R)-1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 118722415 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3R)-1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1[C@H](CO)C[C@@H]2CCCC[C@@H]21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H25F3N2O2/c20-15-9-17(22)16(21)7-12(15)5-13(23)8-19(26)24-14(10-25)6-11-3-1-2-4-18(11)24/h7,9,11,13-14,18,25H,1-6,8,10,23H2/t11-,13+,14-,18-/m0/s1 |
| InChIKey | JJTBTXLRWMNOIC-KTMFAHBVSA-N |
| XLogP | 2.52 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|