About 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile
4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile (PubChem CID 118722441) has the molecular formula C18H15N3O3
and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile |
| PubChem CID | 118722441 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile |
| SMILES | COc1cc2ncn(Cc3ccc(C#N)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C18H15N3O3/c1-23-16-7-14-15(8-17(16)24-2)20-11-21(18(14)22)10-13-5-3-12(9-19)4-6-13/h3-8,11H,10H2,1-2H3 |
| InChIKey | JKXXXWGAZSBKEO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The IUPAC name of 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile (CID 118722441) is 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile.
What is the SMILES notation for 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The canonical SMILES for 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile is COc1cc2ncn(Cc3ccc(C#N)cc3)c(=O)c2cc1OC.
What is the InChIKey of 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The InChIKey is JKXXXWGAZSBKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3/c1-23-16-7-14-15(8-17(16)24-2)20-11-21(18(14)22)10-13-5-3-12(9-19)4-6-13/h3-8,11H,10H2,1-2H3.
What are the key properties of 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile has a molecular weight of 321.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile is sourced from PubChem (CID 118722441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).