C20H22N2O6 — CID 118722443
6,7-dimethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-one (PubChem CID 118722443) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 6,7-dimethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 118722443 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 6,7-dimethoxy-3-[(3,4,5-trimethoxyphenyl)methyl]quinazolin-4-one |
| SMILES | COc1cc2ncn(Cc3cc(OC)c(OC)c(OC)c3)c(=O)c2cc1OC |
| InChI | InChI=1S/C20H22N2O6/c1-24-15-8-13-14(9-16(15)25-2)21-11-22(20(13)23)10-12-6-17(26-3)19(28-5)18(7-12)27-4/h6-9,11H,10H2,1-5H3 |
| InChIKey | DOXVUEKLXMAJFR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |