C34H46O5 — CID 118722461
(4S)-5-oxo-4-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-phenylmethoxypentanoic acid (PubChem CID 118722461) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is (4S)-5-oxo-4-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-phenylmethoxypentanoic acid.
| Compound Name | (4S)-5-oxo-4-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 118722461 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | (4S)-5-oxo-4-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-5-phenylmethoxypentanoic acid |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C3=C(CC[C@@H]12)[C@@]1(C)CC[C@@H]([C@H](CCC(=O)O)C(=O)OCc2ccccc2)[C@]1(C)CC3 |
| InChI | InChI=1S/C34H46O5/c1-31(2)27-13-12-26-25(32(27,3)18-17-28(31)35)16-20-33(4)24(15-19-34(26,33)5)23(11-14-29(36)37)30(38)39-21-22-9-7-6-8-10-22/h6-10,23-24,27H,11-21H2,1-5H3,(H,36,37)/t23-,24-,27-,32+,33-,34+/m0/s1 |
| InChIKey | VHAMUAPHHPFYFH-XDPXTERHSA-N |
| XLogP | 7.53 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|