C35H48O5 — CID 118722467
1-O-benzyl 5-O-methyl (2S)-2-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanedioate (PubChem CID 118722467) has the molecular formula C35H48O5 and a molecular weight of 548.76 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl (2S)-2-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanedioate.
| Compound Name | 1-O-benzyl 5-O-methyl (2S)-2-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanedioate |
|---|---|
| PubChem CID | 118722467 |
| Molecular Formula | C35H48O5 |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | 1-O-benzyl 5-O-methyl (2S)-2-[(5R,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanedioate |
| SMILES | COC(=O)CC[C@H](C(=O)OCc1ccccc1)[C@@H]1CC[C@]2(C)C3=C(CC[C@@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C35H48O5/c1-32(2)28-14-13-27-26(33(28,3)19-18-29(32)36)17-21-34(4)25(16-20-35(27,34)5)24(12-15-30(37)39-6)31(38)40-22-23-10-8-7-9-11-23/h7-11,24-25,28H,12-22H2,1-6H3/t24-,25-,28-,33+,34-,35+/m0/s1 |
| InChIKey | RYVPHYGDJJEMAV-WZEOZWDXSA-N |
| XLogP | 7.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|