About 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea
1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 118722564) has the molecular formula C14H20N6O3S
and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
Molecular Properties
| Compound Name | 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| PubChem CID | 118722564 |
| Molecular Formula | C14H20N6O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | CN(C(=O)N[C@H]1CCCN(S(C)(=O)=O)C1)c1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C14H20N6O3S/c1-19(12-8-16-13-11(18-12)5-6-15-13)14(21)17-10-4-3-7-20(9-10)24(2,22)23/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,15,16)(H,17,21)/t10-/m0/s1 |
| InChIKey | GJAHMBFLWRYELA-JTQLQIEISA-N |
| XLogP | 0.53 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The IUPAC name of 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (CID 118722564) is 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
What is the SMILES notation for 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The canonical SMILES for 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea is CN(C(=O)N[C@H]1CCCN(S(C)(=O)=O)C1)c1cnc2[nH]ccc2n1.
What is the InChIKey of 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The InChIKey is GJAHMBFLWRYELA-JTQLQIEISA-N. The full InChI is InChI=1S/C14H20N6O3S/c1-19(12-8-16-13-11(18-12)5-6-15-13)14(21)17-10-4-3-7-20(9-10)24(2,22)23/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,15,16)(H,17,21)/t10-/m0/s1.
What are the key properties of 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea has a molecular weight of 352.42 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(3S)-1-methylsulfonylpiperidin-3-yl]-1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea is sourced from PubChem (CID 118722564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).