C20H21FN4O6 — CID 118722568
17'-fluoro-13'-(methoxymethyl)-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 118722568) has the molecular formula C20H21FN4O6 and a molecular weight of 432.41 g/mol. Its IUPAC name is 17'-fluoro-13'-(methoxymethyl)-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | 17'-fluoro-13'-(methoxymethyl)-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 118722568 |
| Molecular Formula | C20H21FN4O6 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 17'-fluoro-13'-(methoxymethyl)-4',6'-dimethylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | COCc1noc2c(F)c3c(cc12)CC1(C(=O)NC(=O)NC1=O)C1C(C)OC(C)CN31 |
| InChI | InChI=1S/C20H21FN4O6/c1-8-6-25-14-10(4-11-12(7-29-3)24-31-15(11)13(14)21)5-20(16(25)9(2)30-8)17(26)22-19(28)23-18(20)27/h4,8-9,16H,5-7H2,1-3H3,(H2,22,23,26,27,28) |
| InChIKey | LOKRLVDIXVYVSI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|