C19H28O3 — CID 118722627
methyl (1R,4aR,4bS,8aR,10aR)-1,4a,8-trimethyl-6-oxo-3,4,4b,5,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 118722627) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl (1R,4aR,4bS,8aR,10aR)-1,4a,8-trimethyl-6-oxo-3,4,4b,5,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aR,4bS,8aR,10aR)-1,4a,8-trimethyl-6-oxo-3,4,4b,5,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 118722627 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl (1R,4aR,4bS,8aR,10aR)-1,4a,8-trimethyl-6-oxo-3,4,4b,5,8a,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CC[C@H]1C(C)=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-12-10-13(20)11-15-14(12)6-7-16-18(15,2)8-5-9-19(16,3)17(21)22-4/h10,14-16H,5-9,11H2,1-4H3/t14-,15-,16+,18+,19+/m0/s1 |
| InChIKey | IBZUDILJFPZHNQ-AEXBHSQCSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |