C21H28O4 — CID 118722628
methyl (4R,4aR,6aS,7R,11aR,11bR)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate (PubChem CID 118722628) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl (4R,4aR,6aS,7R,11aR,11bR)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate.
| Compound Name | methyl (4R,4aR,6aS,7R,11aR,11bR)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 118722628 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl (4R,4aR,6aS,7R,11aR,11bR)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CC[C@H]1[C@@H](C)C3=CC(=O)OC3=C[C@@H]12 |
| InChI | InChI=1S/C21H28O4/c1-12-13-6-7-17-20(2,8-5-9-21(17,3)19(23)24-4)15(13)11-16-14(12)10-18(22)25-16/h10-13,15,17H,5-9H2,1-4H3/t12-,13+,15+,17-,20-,21-/m1/s1 |
| InChIKey | MKJJWVLPTZDSTH-PCKVVBOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |