About N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine
N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine (PubChem CID 118722716) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine |
| PubChem CID | 118722716 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine |
| SMILES | CN(C)Cc1cc2cnccc2s1 |
| InChI | InChI=1S/C10H12N2S/c1-12(2)7-9-5-8-6-11-4-3-10(8)13-9/h3-6H,7H2,1-2H3 |
| InChIKey | HZFBTQKLAMCOQG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The IUPAC name of N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine (CID 118722716) is N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine.
What is the SMILES notation for N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The canonical SMILES for N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine is CN(C)Cc1cc2cnccc2s1.
What is the InChIKey of N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
The InChIKey is HZFBTQKLAMCOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-12(2)7-9-5-8-6-11-4-3-10(8)13-9/h3-6H,7H2,1-2H3.
What are the key properties of N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine?
N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine has a molecular weight of 192.29 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-thieno[3,2-c]pyridin-2-ylmethanamine is sourced from PubChem (CID 118722716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).