C20H35NO3 — CID 118722919
(3S,6E,13R,15R)-15-tert-butyl-3,8,13-trimethyl-1-oxa-8-azacyclopentadec-6-ene-2,9-dione (PubChem CID 118722919) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (3S,6E,13R,15R)-15-tert-butyl-3,8,13-trimethyl-1-oxa-8-azacyclopentadec-6-ene-2,9-dione.
| Compound Name | (3S,6E,13R,15R)-15-tert-butyl-3,8,13-trimethyl-1-oxa-8-azacyclopentadec-6-ene-2,9-dione |
|---|---|
| PubChem CID | 118722919 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (3S,6E,13R,15R)-15-tert-butyl-3,8,13-trimethyl-1-oxa-8-azacyclopentadec-6-ene-2,9-dione |
| SMILES | C[C@@H]1CCCC(=O)N(C)/C=C/CC[C@H](C)C(=O)O[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C20H35NO3/c1-15-10-9-12-18(22)21(6)13-8-7-11-16(2)19(23)24-17(14-15)20(3,4)5/h8,13,15-17H,7,9-12,14H2,1-6H3/b13-8+/t15-,16+,17-/m1/s1 |
| InChIKey | WRIPSIKIDAUKBP-NRXUCUCMSA-N |
| XLogP | 4.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |