About 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine
4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine (PubChem CID 118722991) has the molecular formula C21H29N3O
and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine.
Molecular Properties
| Compound Name | 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine |
| PubChem CID | 118722991 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine |
| SMILES | Cc1cc(OCCCN2CC(C)CC(C)C2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H29N3O/c1-16-12-17(2)15-24(14-16)10-7-11-25-20-13-18(3)22-21(23-20)19-8-5-4-6-9-19/h4-6,8-9,13,16-17H,7,10-12,14-15H2,1-3H3 |
| InChIKey | IYMJEFOSJKFKDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine?
The IUPAC name of 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine (CID 118722991) is 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine.
What is the SMILES notation for 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine?
The canonical SMILES for 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine is Cc1cc(OCCCN2CC(C)CC(C)C2)nc(-c2ccccc2)n1.
What is the InChIKey of 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine?
The InChIKey is IYMJEFOSJKFKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O/c1-16-12-17(2)15-24(14-16)10-7-11-25-20-13-18(3)22-21(23-20)19-8-5-4-6-9-19/h4-6,8-9,13,16-17H,7,10-12,14-15H2,1-3H3.
What are the key properties of 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine?
4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine has a molecular weight of 339.48 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methyl-2-phenylpyrimidine is sourced from PubChem (CID 118722991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).