About 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one
5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 118723032) has the molecular formula C23H21NO3
and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
Molecular Properties
| Compound Name | 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| PubChem CID | 118723032 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1c(O)cccc1C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H21NO3/c1-23(2)10-18(26)21-19(11-23)27-22-14(7-5-9-17(22)25)20(21)15-12-24-16-8-4-3-6-13(15)16/h3-9,12,20,24-25H,10-11H2,1-2H3 |
| InChIKey | LWZUOUSBLXMHGO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The IUPAC name of 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (CID 118723032) is 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
What is the SMILES notation for 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The canonical SMILES for 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one is CC1(C)CC(=O)C2=C(C1)Oc1c(O)cccc1C2c1c[nH]c2ccccc12.
What is the InChIKey of 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The InChIKey is LWZUOUSBLXMHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-23(2)10-18(26)21-19(11-23)27-22-14(7-5-9-17(22)25)20(21)15-12-24-16-8-4-3-6-13(15)16/h3-9,12,20,24-25H,10-11H2,1-2H3.
What are the key properties of 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one has a molecular weight of 359.43 g/mol, XLogP of 5.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one is sourced from PubChem (CID 118723032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).