About 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one
9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 118723033) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
Molecular Properties
| Compound Name | 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| PubChem CID | 118723033 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | COc1ccc2c(c1)OC1=C(C(=O)CC(C)(C)C1)C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H23NO3/c1-24(2)11-19(26)23-21(12-24)28-20-10-14(27-3)8-9-16(20)22(23)17-13-25-18-7-5-4-6-15(17)18/h4-10,13,22,25H,11-12H2,1-3H3 |
| InChIKey | ZYUKIYCEWARRJA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The IUPAC name of 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (CID 118723033) is 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
What is the SMILES notation for 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The canonical SMILES for 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one is COc1ccc2c(c1)OC1=C(C(=O)CC(C)(C)C1)C2c1c[nH]c2ccccc12.
What is the InChIKey of 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
The InChIKey is ZYUKIYCEWARRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-24(2)11-19(26)23-21(12-24)28-20-10-14(27-3)8-9-16(20)22(23)17-13-25-18-7-5-4-6-15(17)18/h4-10,13,22,25H,11-12H2,1-3H3.
What are the key properties of 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one?
9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one has a molecular weight of 373.45 g/mol, XLogP of 5.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1H-indol-3-yl)-6-methoxy-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one is sourced from PubChem (CID 118723033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).