C31H37NO2 — CID 118723035
5,7-ditert-butyl-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 118723035) has the molecular formula C31H37NO2 and a molecular weight of 455.64 g/mol. Its IUPAC name is 5,7-ditert-butyl-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 5,7-ditert-butyl-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 118723035 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 5,7-ditert-butyl-9-(1H-indol-3-yl)-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H37NO2/c1-29(2,3)18-13-20-26(21-17-32-23-12-10-9-11-19(21)23)27-24(33)15-31(7,8)16-25(27)34-28(20)22(14-18)30(4,5)6/h9-14,17,26,32H,15-16H2,1-8H3 |
| InChIKey | ZCYYHXVAGZIBGW-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |