About 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one
12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one (PubChem CID 118723038) has the molecular formula C27H23NO2
and a molecular weight of 393.49 g/mol. Its IUPAC name is 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one.
Molecular Properties
| Compound Name | 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one |
| PubChem CID | 118723038 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccc3ccccc3c1C2c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H23NO2/c1-27(2)13-21(29)26-23(14-27)30-22-12-11-16-7-3-4-8-17(16)24(22)25(26)19-15-28-20-10-6-5-9-18(19)20/h3-12,15,25,28H,13-14H2,1-2H3 |
| InChIKey | VMUCEMQMGOMEOC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one?
The IUPAC name of 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one (CID 118723038) is 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one.
What is the SMILES notation for 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one?
The canonical SMILES for 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one is CC1(C)CC(=O)C2=C(C1)Oc1ccc3ccccc3c1C2c1c[nH]c2ccccc12.
What is the InChIKey of 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one?
The InChIKey is VMUCEMQMGOMEOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23NO2/c1-27(2)13-21(29)26-23(14-27)30-22-12-11-16-7-3-4-8-17(16)24(22)25(26)19-15-28-20-10-6-5-9-18(19)20/h3-12,15,25,28H,13-14H2,1-2H3.
What are the key properties of 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one?
12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one has a molecular weight of 393.49 g/mol, XLogP of 6.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(1H-indol-3-yl)-9,9-dimethyl-10,12-dihydro-8H-benzo[a]xanthen-11-one is sourced from PubChem (CID 118723038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).