C21H17NO3 — CID 118723039
6-hydroxy-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one (PubChem CID 118723039) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-hydroxy-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one.
| Compound Name | 6-hydroxy-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one |
|---|---|
| PubChem CID | 118723039 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 6-hydroxy-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one |
| SMILES | O=C1CCCC2=C1C(c1c[nH]c3ccccc13)c1ccc(O)cc1O2 |
| InChI | InChI=1S/C21H17NO3/c23-12-8-9-14-19(10-12)25-18-7-3-6-17(24)21(18)20(14)15-11-22-16-5-2-1-4-13(15)16/h1-2,4-5,8-11,20,22-23H,3,6-7H2 |
| InChIKey | YUTSBWCOZUIMHX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |