C21H16BrNO2 — CID 118723042
7-bromo-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one (PubChem CID 118723042) has the molecular formula C21H16BrNO2 and a molecular weight of 394.27 g/mol. Its IUPAC name is 7-bromo-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one.
| Compound Name | 7-bromo-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one |
|---|---|
| PubChem CID | 118723042 |
| Molecular Formula | C21H16BrNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 7-bromo-9-(1H-indol-3-yl)-2,3,4,9-tetrahydroxanthen-1-one |
| SMILES | O=C1CCCC2=C1C(c1c[nH]c3ccccc13)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C21H16BrNO2/c22-12-8-9-18-14(10-12)20(21-17(24)6-3-7-19(21)25-18)15-11-23-16-5-2-1-4-13(15)16/h1-2,4-5,8-11,20,23H,3,6-7H2 |
| InChIKey | ISIGNTPRTCGRQQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |