C21H20N4O3 — CID 11872313
(4S)-5-(furan-2-yl)-3-hydroxy-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one (PubChem CID 11872313) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (4S)-5-(furan-2-yl)-3-hydroxy-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one.
| Compound Name | (4S)-5-(furan-2-yl)-3-hydroxy-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11872313 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (4S)-5-(furan-2-yl)-3-hydroxy-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
| SMILES | O=C1CC(c2ccco2)[C@H](n2cncn2)C(O)=C1[C@H]1NCCc2ccccc21 |
| InChI | InChI=1S/C21H20N4O3/c26-16-10-15(17-6-3-9-28-17)20(25-12-22-11-24-25)21(27)18(16)19-14-5-2-1-4-13(14)7-8-23-19/h1-6,9,11-12,15,19-20,23,27H,7-8,10H2/t15?,19-,20-/m0/s1 |
| InChIKey | HNMKGYDXVKLMFB-FIRGRZAASA-N |
| XLogP | 2.87 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |