About 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one
5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one (PubChem CID 118723149) has the molecular formula C19H17ClO4S
and a molecular weight of 376.86 g/mol. Its IUPAC name is 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one |
| PubChem CID | 118723149 |
| Molecular Formula | C19H17ClO4S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one |
| SMILES | CCOc1ccccc1C1CC(O)=C(Sc2ccccc2Cl)C(=O)O1 |
| InChI | InChI=1S/C19H17ClO4S/c1-2-23-15-9-5-3-7-12(15)16-11-14(21)18(19(22)24-16)25-17-10-6-4-8-13(17)20/h3-10,16,21H,2,11H2,1H3 |
| InChIKey | DMQLJOBNMGRYLK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one?
The IUPAC name of 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one (CID 118723149) is 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one?
The canonical SMILES for 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one is CCOc1ccccc1C1CC(O)=C(Sc2ccccc2Cl)C(=O)O1.
What is the InChIKey of 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one?
The InChIKey is DMQLJOBNMGRYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClO4S/c1-2-23-15-9-5-3-7-12(15)16-11-14(21)18(19(22)24-16)25-17-10-6-4-8-13(17)20/h3-10,16,21H,2,11H2,1H3.
What are the key properties of 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one?
5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one has a molecular weight of 376.86 g/mol, XLogP of 5.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)sulfanyl-2-(2-ethoxyphenyl)-4-hydroxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 118723149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).