About 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid
2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid (PubChem CID 118723224) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid |
| PubChem CID | 118723224 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)N1CCC2(CCc3ccccc32)CC1 |
| InChI | InChI=1S/C21H22N2O3/c24-19(25)16-6-2-4-8-18(16)22-20(26)23-13-11-21(12-14-23)10-9-15-5-1-3-7-17(15)21/h1-8H,9-14H2,(H,22,26)(H,24,25) |
| InChIKey | LTJHJZHKOPRHQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid?
The IUPAC name of 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid (CID 118723224) is 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid.
What is the SMILES notation for 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid?
The canonical SMILES for 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid is O=C(O)c1ccccc1NC(=O)N1CCC2(CCc3ccccc32)CC1.
What is the InChIKey of 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid?
The InChIKey is LTJHJZHKOPRHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c24-19(25)16-6-2-4-8-18(16)22-20(26)23-13-11-21(12-14-23)10-9-15-5-1-3-7-17(15)21/h1-8H,9-14H2,(H,22,26)(H,24,25).
What are the key properties of 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid?
2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid has a molecular weight of 350.42 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carbonylamino)benzoic acid is sourced from PubChem (CID 118723224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).