C21H27N3O — CID 118723359
2-phenyl-4-(3-pyrrolidin-1-ylpropoxy)-5,6,7,8-tetrahydroquinazoline (PubChem CID 118723359) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-phenyl-4-(3-pyrrolidin-1-ylpropoxy)-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2-phenyl-4-(3-pyrrolidin-1-ylpropoxy)-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 118723359 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-phenyl-4-(3-pyrrolidin-1-ylpropoxy)-5,6,7,8-tetrahydroquinazoline |
| SMILES | c1ccc(-c2nc3c(c(OCCCN4CCCC4)n2)CCCC3)cc1 |
| InChI | InChI=1S/C21H27N3O/c1-2-9-17(10-3-1)20-22-19-12-5-4-11-18(19)21(23-20)25-16-8-15-24-13-6-7-14-24/h1-3,9-10H,4-8,11-16H2 |
| InChIKey | QYPADQAVODSZMK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|