C26H42O4 — CID 11872344
methyl (4R)-4-[(3R,5S,8R,10S,12S,13R,14S,17S)-3-hydroxy-12-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 11872344) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5S,8R,10S,12S,13R,14S,17S)-3-hydroxy-12-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5S,8R,10S,12S,13R,14S,17S)-3-hydroxy-12-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 11872344 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | methyl (4R)-4-[(3R,5S,8R,10S,12S,13R,14S,17S)-3-hydroxy-12-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@@H]1CC[C@H]2[C@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)C3=C[C@H](OC)[C@]12C |
| InChI | InChI=1S/C26H42O4/c1-16(6-11-24(28)30-5)20-9-10-21-19-8-7-17-14-18(27)12-13-25(17,2)22(19)15-23(29-4)26(20,21)3/h15-21,23,27H,6-14H2,1-5H3/t16-,17+,18-,19-,20+,21+,23+,25+,26-/m1/s1 |
| InChIKey | PKKAVGRGAYJIIP-QZIVKDDFSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|