About 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one
2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one (PubChem CID 118723558) has the molecular formula C23H13FN2O5
and a molecular weight of 416.36 g/mol. Its IUPAC name is 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one.
Molecular Properties
| Compound Name | 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one |
| PubChem CID | 118723558 |
| Molecular Formula | C23H13FN2O5 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2c(/C=C/c2ccc([N+](=O)[O-])o2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C23H13FN2O5/c1-30-14-3-6-15-16(11-14)23(27)22-17-10-12(24)2-7-18(17)25-19(21(15)22)8-4-13-5-9-20(31-13)26(28)29/h2-11H,1H3/b8-4+ |
| InChIKey | VDZVSNPXMIVNMB-XBXARRHUSA-N |
| XLogP | 5.27 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one?
The IUPAC name of 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one (CID 118723558) is 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one.
What is the SMILES notation for 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one?
The canonical SMILES for 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one is COc1ccc2c(c1)C(=O)c1c-2c(/C=C/c2ccc([N+](=O)[O-])o2)nc2ccc(F)cc12.
What is the InChIKey of 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one?
The InChIKey is VDZVSNPXMIVNMB-XBXARRHUSA-N. The full InChI is InChI=1S/C23H13FN2O5/c1-30-14-3-6-15-16(11-14)23(27)22-17-10-12(24)2-7-18(17)25-19(21(15)22)8-4-13-5-9-20(31-13)26(28)29/h2-11H,1H3/b8-4+.
What are the key properties of 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one?
2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one has a molecular weight of 416.36 g/mol, XLogP of 5.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-9-methoxy-6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]indeno[1,2-c]quinolin-11-one is sourced from PubChem (CID 118723558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).