About 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione
3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 118723714) has the molecular formula C21H13NO5
and a molecular weight of 359.34 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
Molecular Properties
| Compound Name | 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| PubChem CID | 118723714 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | O=C1C=CC2(C=C1)OC(=O)C(c1ccc([N+](=O)[O-])cc1)=C2c1ccccc1 |
| InChI | InChI=1S/C21H13NO5/c23-17-10-12-21(13-11-17)19(15-4-2-1-3-5-15)18(20(24)27-21)14-6-8-16(9-7-14)22(25)26/h1-13H |
| InChIKey | LAHAOXZYTURRBQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The IUPAC name of 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione (CID 118723714) is 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione.
What is the SMILES notation for 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The canonical SMILES for 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione is O=C1C=CC2(C=C1)OC(=O)C(c1ccc([N+](=O)[O-])cc1)=C2c1ccccc1.
What is the InChIKey of 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
The InChIKey is LAHAOXZYTURRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13NO5/c23-17-10-12-21(13-11-17)19(15-4-2-1-3-5-15)18(20(24)27-21)14-6-8-16(9-7-14)22(25)26/h1-13H.
What are the key properties of 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione?
3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione has a molecular weight of 359.34 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitrophenyl)-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-triene-2,8-dione is sourced from PubChem (CID 118723714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).