C22H14O5 — CID 118723722
4-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)benzoic acid (PubChem CID 118723722) has the molecular formula C22H14O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)benzoic acid.
| Compound Name | 4-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)benzoic acid |
|---|---|
| PubChem CID | 118723722 |
| Molecular Formula | C22H14O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)benzoic acid |
| SMILES | O=C1C=CC2(C=C1)OC(=O)C(c1ccc(C(=O)O)cc1)=C2c1ccccc1 |
| InChI | InChI=1S/C22H14O5/c23-17-10-12-22(13-11-17)19(15-4-2-1-3-5-15)18(21(26)27-22)14-6-8-16(9-7-14)20(24)25/h1-13H,(H,24,25) |
| InChIKey | RMNOSNBLKAPNOZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|