C18H21NO8 — CID 118723861
methyl (E)-3-[3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-2-yl]prop-2-enoate (PubChem CID 118723861) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl (E)-3-[3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 118723861 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | methyl (E)-3-[3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1[nH]c2ccccc2c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H21NO8/c1-25-13(21)7-6-11-17(9-4-2-3-5-10(9)19-11)27-18-16(24)15(23)14(22)12(8-20)26-18/h2-7,12,14-16,18-20,22-24H,8H2,1H3/b7-6+/t12-,14-,15+,16-,18+/m1/s1 |
| InChIKey | LLPDBOYFWRDKEB-GYCGVBOISA-N |
| XLogP | -0.47 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|