C22H23N5O2 — CID 118723893
4-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]benzoic acid (PubChem CID 118723893) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 118723893 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]benzoic acid |
| SMILES | CN1CCN(c2ccc(-c3cnc(N)c(-c4ccc(C(=O)O)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H23N5O2/c1-26-10-12-27(13-11-26)18-8-6-15(7-9-18)19-14-24-21(23)20(25-19)16-2-4-17(5-3-16)22(28)29/h2-9,14H,10-13H2,1H3,(H2,23,24)(H,28,29) |
| InChIKey | BFNGMSVLFMWNFD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |