About ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate
ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate (PubChem CID 118723952) has the molecular formula C22H23NO6
and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate |
| PubChem CID | 118723952 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)n2ccc(C)cc12 |
| InChI | InChI=1S/C22H23NO6/c1-6-29-22(25)15-12-17(23-8-7-13(2)9-16(15)23)20(24)14-10-18(26-3)21(28-5)19(11-14)27-4/h7-12H,6H2,1-5H3 |
| InChIKey | HKUKFUZUBLJXEO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The IUPAC name of ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate (CID 118723952) is ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate.
What is the SMILES notation for ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The canonical SMILES for ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate is CCOC(=O)c1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)n2ccc(C)cc12.
What is the InChIKey of ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The InChIKey is HKUKFUZUBLJXEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO6/c1-6-29-22(25)15-12-17(23-8-7-13(2)9-16(15)23)20(24)14-10-18(26-3)21(28-5)19(11-14)27-4/h7-12H,6H2,1-5H3.
What are the key properties of ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate has a molecular weight of 397.43 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-methyl-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate is sourced from PubChem (CID 118723952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).