About ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate
ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate (PubChem CID 118723959) has the molecular formula C22H20N2O6
and a molecular weight of 408.41 g/mol. Its IUPAC name is ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate |
| PubChem CID | 118723959 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)n2cccc(C#N)c12 |
| InChI | InChI=1S/C22H20N2O6/c1-5-30-22(26)15-11-16(24-8-6-7-13(12-23)19(15)24)20(25)14-9-17(27-2)21(29-4)18(10-14)28-3/h6-11H,5H2,1-4H3 |
| InChIKey | DPFCZZPAPRFMEY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The IUPAC name of ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate (CID 118723959) is ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate.
What is the SMILES notation for ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The canonical SMILES for ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate is CCOC(=O)c1cc(C(=O)c2cc(OC)c(OC)c(OC)c2)n2cccc(C#N)c12.
What is the InChIKey of ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
The InChIKey is DPFCZZPAPRFMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O6/c1-5-30-22(26)15-11-16(24-8-6-7-13(12-23)19(15)24)20(25)14-9-17(27-2)21(29-4)18(10-14)28-3/h6-11H,5H2,1-4H3.
What are the key properties of ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate?
ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate has a molecular weight of 408.41 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-cyano-3-(3,4,5-trimethoxybenzoyl)indolizine-1-carboxylate is sourced from PubChem (CID 118723959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).