C20H12O4S — CID 118724066
5-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)thiophene-2-carbaldehyde (PubChem CID 118724066) has the molecular formula C20H12O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 5-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)thiophene-2-carbaldehyde.
| Compound Name | 5-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 118724066 |
| Molecular Formula | C20H12O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-(2,8-dioxo-4-phenyl-1-oxaspiro[4.5]deca-3,6,9-trien-3-yl)thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(C2=C(c3ccccc3)C3(C=CC(=O)C=C3)OC2=O)s1 |
| InChI | InChI=1S/C20H12O4S/c21-12-15-6-7-16(25-15)17-18(13-4-2-1-3-5-13)20(24-19(17)23)10-8-14(22)9-11-20/h1-12H |
| InChIKey | SROFTRBNMMBYQY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|