C42H34N6O2 — CID 118724223
(1R,2R,3R)-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxo-1'-prop-2-enylspiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile (PubChem CID 118724223) has the molecular formula C42H34N6O2 and a molecular weight of 654.77 g/mol. Its IUPAC name is (1R,2R,3R)-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxo-1'-prop-2-enylspiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile.
| Compound Name | (1R,2R,3R)-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxo-1'-prop-2-enylspiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
|---|---|
| PubChem CID | 118724223 |
| Molecular Formula | C42H34N6O2 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | (1R,2R,3R)-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxo-1'-prop-2-enylspiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
| SMILES | C=CCN1C(=O)[C@]2(c3ccccc31)[C@H](c1cn(-c3ccccc3)nc1-c1ccccc1)[C@@](C#N)(C(=O)c1c[nH]c3ccccc13)C1CCCN12 |
| InChI | InChI=1S/C42H34N6O2/c1-2-23-46-35-21-12-10-19-33(35)42(40(46)50)38(32-26-48(29-16-7-4-8-17-29)45-37(32)28-14-5-3-6-15-28)41(27-43,36-22-13-24-47(36)42)39(49)31-25-44-34-20-11-9-18-30(31)34/h2-12,14-21,25-26,36,38,44H,1,13,22-24H2/t36?,38-,41+,42+/m1/s1 |
| InChIKey | AIEPOCFOPQWQTQ-NBRVXRETSA-N |
| XLogP | 7.40 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|