C46H36N6O2 — CID 118724224
(1R,2R,3R)-1'-benzyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile (PubChem CID 118724224) has the molecular formula C46H36N6O2 and a molecular weight of 704.83 g/mol. Its IUPAC name is (1R,2R,3R)-1'-benzyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile.
| Compound Name | (1R,2R,3R)-1'-benzyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
|---|---|
| PubChem CID | 118724224 |
| Molecular Formula | C46H36N6O2 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | (1R,2R,3R)-1'-benzyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
| SMILES | N#C[C@]1(C(=O)c2c[nH]c3ccccc23)C2CCCN2[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@@H]1c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C46H36N6O2/c47-30-45(43(53)35-27-48-38-23-12-10-21-34(35)38)40-25-14-26-51(40)46(37-22-11-13-24-39(37)50(44(46)54)28-31-15-4-1-5-16-31)42(45)36-29-52(33-19-8-3-9-20-33)49-41(36)32-17-6-2-7-18-32/h1-13,15-24,27,29,40,42,48H,14,25-26,28H2/t40?,42-,45+,46+/m1/s1 |
| InChIKey | WUGOSUDUKWOXIJ-MHVPCMDFSA-N |
| XLogP | 8.42 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |