C43H38N6O2 — CID 118724225
(1R,2R,3R)-1'-butyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile (PubChem CID 118724225) has the molecular formula C43H38N6O2 and a molecular weight of 670.82 g/mol. Its IUPAC name is (1R,2R,3R)-1'-butyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile.
| Compound Name | (1R,2R,3R)-1'-butyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
|---|---|
| PubChem CID | 118724225 |
| Molecular Formula | C43H38N6O2 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | (1R,2R,3R)-1'-butyl-2-(1,3-diphenylpyrazol-4-yl)-1-(1H-indole-3-carbonyl)-2'-oxospiro[5,6,7,8-tetrahydro-2H-pyrrolizine-3,3'-indole]-1-carbonitrile |
| SMILES | CCCCN1C(=O)[C@]2(c3ccccc31)[C@H](c1cn(-c3ccccc3)nc1-c1ccccc1)[C@@](C#N)(C(=O)c1c[nH]c3ccccc13)C1CCCN12 |
| InChI | InChI=1S/C43H38N6O2/c1-2-3-24-47-36-22-13-11-20-34(36)43(41(47)51)39(33-27-49(30-17-8-5-9-18-30)46-38(33)29-15-6-4-7-16-29)42(28-44,37-23-14-25-48(37)43)40(50)32-26-45-35-21-12-10-19-31(32)35/h4-13,15-22,26-27,37,39,45H,2-3,14,23-25H2,1H3/t37?,39-,42+,43+/m1/s1 |
| InChIKey | CENYGJFPVKWSKL-ZRYLQVHWSA-N |
| XLogP | 8.02 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |