C22H27N3 — CID 118724295
N-benzyl-N-methyl-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-amine (PubChem CID 118724295) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-amine.
| Compound Name | N-benzyl-N-methyl-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 118724295 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-benzyl-N-methyl-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-amine |
| SMILES | CN(CCCN1CCc2c([nH]c3ccccc23)C1)Cc1ccccc1 |
| InChI | InChI=1S/C22H27N3/c1-24(16-18-8-3-2-4-9-18)13-7-14-25-15-12-20-19-10-5-6-11-21(19)23-22(20)17-25/h2-6,8-11,23H,7,12-17H2,1H3 |
| InChIKey | CEFYRHKEFRHEIC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|