C24H24N6O2 — CID 118724397
4-[[[4-(3-azidophenyl)-6-phenylpyrimidin-2-yl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 118724397) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 4-[[[4-(3-azidophenyl)-6-phenylpyrimidin-2-yl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[4-(3-azidophenyl)-6-phenylpyrimidin-2-yl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118724397 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-[[[4-(3-azidophenyl)-6-phenylpyrimidin-2-yl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1cccc(-c2cc(-c3ccccc3)nc(NCC3CCC(C(=O)O)CC3)n2)c1 |
| InChI | InChI=1S/C24H24N6O2/c25-30-29-20-8-4-7-19(13-20)22-14-21(17-5-2-1-3-6-17)27-24(28-22)26-15-16-9-11-18(12-10-16)23(31)32/h1-8,13-14,16,18H,9-12,15H2,(H,31,32)(H,26,27,28) |
| InChIKey | NIZOQSOPJDPFMB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|