C17H21NO3 — CID 118724460
methyl 2-[(4S,4aR,8aR)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetate (PubChem CID 118724460) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 2-[(4S,4aR,8aR)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetate.
| Compound Name | methyl 2-[(4S,4aR,8aR)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetate |
|---|---|
| PubChem CID | 118724460 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl 2-[(4S,4aR,8aR)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetate |
| SMILES | COC(=O)CC1=NO[C@@H]2CCCC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-20-16(19)11-14-17(12-7-3-2-4-8-12)13-9-5-6-10-15(13)21-18-14/h2-4,7-8,13,15,17H,5-6,9-11H2,1H3/t13-,15+,17+/m0/s1 |
| InChIKey | OHJUCGBQCRJJEK-YSVLISHTSA-N |
| XLogP | 3.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |