About (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one
(3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one (PubChem CID 118724548) has the molecular formula C21H17NO3
and a molecular weight of 331.37 g/mol. Its IUPAC name is (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one.
Molecular Properties
| Compound Name | (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one |
| PubChem CID | 118724548 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one |
| SMILES | O=C1[C@@H](c2ccccc2)[C@H](c2ccc(O)cc2)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H17NO3/c23-17-10-6-15(7-11-17)20-19(14-4-2-1-3-5-14)21(25)22(20)16-8-12-18(24)13-9-16/h1-13,19-20,23-24H/t19-,20-/m0/s1 |
| InChIKey | JHRCZSAGRUZCAI-PMACEKPBSA-N |
| XLogP | 3.97 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one?
The IUPAC name of (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one (CID 118724548) is (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one.
What is the SMILES notation for (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one?
The canonical SMILES for (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one is O=C1[C@@H](c2ccccc2)[C@H](c2ccc(O)cc2)N1c1ccc(O)cc1.
What is the InChIKey of (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one?
The InChIKey is JHRCZSAGRUZCAI-PMACEKPBSA-N. The full InChI is InChI=1S/C21H17NO3/c23-17-10-6-15(7-11-17)20-19(14-4-2-1-3-5-14)21(25)22(20)16-8-12-18(24)13-9-16/h1-13,19-20,23-24H/t19-,20-/m0/s1.
What are the key properties of (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one?
(3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one has a molecular weight of 331.37 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1,4-bis(4-hydroxyphenyl)-3-phenylazetidin-2-one is sourced from PubChem (CID 118724548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).