C21H17NO4 — CID 118724549
(3S,4R)-1,3,4-tris(4-hydroxyphenyl)azetidin-2-one (PubChem CID 118724549) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (3S,4R)-1,3,4-tris(4-hydroxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-1,3,4-tris(4-hydroxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 118724549 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (3S,4R)-1,3,4-tris(4-hydroxyphenyl)azetidin-2-one |
| SMILES | O=C1[C@@H](c2ccc(O)cc2)[C@H](c2ccc(O)cc2)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C21H17NO4/c23-16-7-1-13(2-8-16)19-20(14-3-9-17(24)10-4-14)22(21(19)26)15-5-11-18(25)12-6-15/h1-12,19-20,23-25H/t19-,20-/m0/s1 |
| InChIKey | BMKPNQVPLOCMLU-PMACEKPBSA-N |
| XLogP | 3.68 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |