About (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one
(4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one (PubChem CID 118724552) has the molecular formula C27H21NO3
and a molecular weight of 407.47 g/mol. Its IUPAC name is (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one |
| PubChem CID | 118724552 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one |
| SMILES | O=C1N(c2ccc(O)cc2)[C@@H](c2ccc(O)cc2)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21NO3/c29-23-15-11-19(12-16-23)25-27(20-7-3-1-4-8-20,21-9-5-2-6-10-21)26(31)28(25)22-13-17-24(30)18-14-22/h1-18,25,29-30H/t25-/m0/s1 |
| InChIKey | SITHONSGWKZBPC-VWLOTQADSA-N |
| XLogP | 5.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one?
The IUPAC name of (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one (CID 118724552) is (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one.
What is the SMILES notation for (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one?
The canonical SMILES for (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one is O=C1N(c2ccc(O)cc2)[C@@H](c2ccc(O)cc2)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one?
The InChIKey is SITHONSGWKZBPC-VWLOTQADSA-N. The full InChI is InChI=1S/C27H21NO3/c29-23-15-11-19(12-16-23)25-27(20-7-3-1-4-8-20,21-9-5-2-6-10-21)26(31)28(25)22-13-17-24(30)18-14-22/h1-18,25,29-30H/t25-/m0/s1.
What are the key properties of (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one?
(4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one has a molecular weight of 407.47 g/mol, XLogP of 5.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,4-bis(4-hydroxyphenyl)-3,3-diphenylazetidin-2-one is sourced from PubChem (CID 118724552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).