About N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide
N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide (PubChem CID 118724564) has the molecular formula C15H15N5O3S
and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide |
| PubChem CID | 118724564 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3ncncc3[nH]2)cc1OC |
| InChI | InChI=1S/C15H15N5O3S/c1-22-11-4-3-9(5-12(11)23-2)18-13(21)7-24-15-19-10-6-16-8-17-14(10)20-15/h3-6,8H,7H2,1-2H3,(H,18,21)(H,16,17,19,20) |
| InChIKey | HMQXROGMLNLODZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide (CID 118724564) is N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide is COc1ccc(NC(=O)CSc2nc3ncncc3[nH]2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide?
The InChIKey is HMQXROGMLNLODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3S/c1-22-11-4-3-9(5-12(11)23-2)18-13(21)7-24-15-19-10-6-16-8-17-14(10)20-15/h3-6,8H,7H2,1-2H3,(H,18,21)(H,16,17,19,20).
What are the key properties of N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide?
N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide has a molecular weight of 345.38 g/mol, XLogP of 2.10, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-2-(7H-purin-8-ylsulfanyl)acetamide is sourced from PubChem (CID 118724564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).