About 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride
1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride (PubChem CID 118724630) has the molecular formula C20H27ClN6O2
and a molecular weight of 418.93 g/mol. Its IUPAC name is 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride |
| PubChem CID | 118724630 |
| Molecular Formula | C20H27ClN6O2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2CCCN2CCN(c3ccccc3)CC2)n(C)c1=O |
| InChI | InChI=1S/C20H26N6O2.ClH/c1-22-18-17(19(27)23(2)20(22)28)26(15-21-18)10-6-9-24-11-13-25(14-12-24)16-7-4-3-5-8-16;/h3-5,7-8,15H,6,9-14H2,1-2H3;1H |
| InChIKey | VVFCOTSQNBOXPP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride?
The IUPAC name of 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride (CID 118724630) is 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride.
What is the SMILES notation for 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride?
The canonical SMILES for 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride is Cl.Cn1c(=O)c2c(ncn2CCCN2CCN(c3ccccc3)CC2)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride?
The InChIKey is VVFCOTSQNBOXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N6O2.ClH/c1-22-18-17(19(27)23(2)20(22)28)26(15-21-18)10-6-9-24-11-13-25(14-12-24)16-7-4-3-5-8-16;/h3-5,7-8,15H,6,9-14H2,1-2H3;1H.
What are the key properties of 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride?
1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride has a molecular weight of 418.93 g/mol, XLogP of 1.07, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7-[3-(4-phenylpiperazin-1-yl)propyl]purine-2,6-dione;hydrochloride is sourced from PubChem (CID 118724630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).