C21H28Cl2N6O2 — CID 118724635
7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 118724635) has the molecular formula C21H28Cl2N6O2 and a molecular weight of 467.40 g/mol. Its IUPAC name is 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 118724635 |
| Molecular Formula | C21H28Cl2N6O2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2CCCCN2CCN(c3cccc(Cl)c3)CC2)n(C)c1=O |
| InChI | InChI=1S/C21H27ClN6O2.ClH/c1-24-19-18(20(29)25(2)21(24)30)28(15-23-19)9-4-3-8-26-10-12-27(13-11-26)17-7-5-6-16(22)14-17;/h5-7,14-15H,3-4,8-13H2,1-2H3;1H |
| InChIKey | CIYYZIMGBLFERV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|