C22H31ClN6O2 — CID 118724639
1,3-dimethyl-7-[5-(4-phenylpiperazin-1-yl)pentyl]purine-2,6-dione;hydrochloride (PubChem CID 118724639) has the molecular formula C22H31ClN6O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 1,3-dimethyl-7-[5-(4-phenylpiperazin-1-yl)pentyl]purine-2,6-dione;hydrochloride.
| Compound Name | 1,3-dimethyl-7-[5-(4-phenylpiperazin-1-yl)pentyl]purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 118724639 |
| Molecular Formula | C22H31ClN6O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1,3-dimethyl-7-[5-(4-phenylpiperazin-1-yl)pentyl]purine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(ncn2CCCCCN2CCN(c3ccccc3)CC2)n(C)c1=O |
| InChI | InChI=1S/C22H30N6O2.ClH/c1-24-20-19(21(29)25(2)22(24)30)28(17-23-20)12-8-4-7-11-26-13-15-27(16-14-26)18-9-5-3-6-10-18;/h3,5-6,9-10,17H,4,7-8,11-16H2,1-2H3;1H |
| InChIKey | XFSRNEHJWUOLTP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|